CAS 858557-69-4

Methanone, (2,6-dimethoxyphenyl)[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-1-piperidinyl]-

Description:

Methanone, (2,6-dimethoxyphenyl)[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-1-piperidinyl]- is a complex organic compound characterized by its unique structural features. It contains a methanone functional group, which is indicative of ketones, and is further substituted with a 2,6-dimethoxyphenyl group, enhancing its aromatic properties. The presence of a piperidine ring contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological effects. Additionally, the compound includes a 1,2,4-oxadiazole moiety, which is known for its diverse applications in medicinal chemistry, particularly in the development of anti-inflammatory and antimicrobial agents. The overall structure suggests that this compound may exhibit interesting interactions due to its multiple functional groups, making it a candidate for further research in drug development. Its CAS number, 858557-69-4, allows for easy identification and retrieval of information in chemical databases. As with many organic compounds, its solubility, stability, and reactivity would depend on the specific conditions under which it is studied.

Formula: C₂₃H₂₅N₃O₄

InChI: InChI=1S/C23H25N3O4/c1-15-7-9-16(10-8-15)21-24-22(30-25-21)17-11-13-26(14-12-17)23(27)20-18(28-2)5-4-6-19(20)29-3/h4-10,17H,11-14H2,1-3H3

InChI key: MPMGADZKWJDRRX-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)C2=NOC(=N2)C3CCN(CC3)C(=O)C4=C(C=CC=C4OC)OC

Synonyms:

• 26S proteasome inhibitor I
• Methanone, (2,6-dimethoxyphenyl)[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-1-piperidinyl]-
• MUN57694

MUN57694

CAS: 858557-69-4

MUN57694

Formula: C₂₃H₂₅N₃O₄

Purity: ≥98%

Molecular weight: 407.46

Ref: 54-BUP07705

MUN57694

CAS: 858557-69-4

MUN57694 is an inhibitor of 26S proteasome.

Formula: C₂₃H₂₅N₃O₄

Purity: 99%

Color and Shape: White Solid

Molecular weight: 407.4623

Ref: TM-T9090