CAS 858971-43-4
:(SP-4-2)-Bis(acetato-κO)[1,1′-[1,2-ethanediylbis(sulfinyl-κS)]bis[benzene]]palladium
Description:
The chemical substance known as "(SP-4-2)-Bis(acetato-κO)[1,1′-[1,2-ethanediylbis(sulfinyl-κS)]bis[benzene]]palladium" is a palladium complex characterized by its coordination with acetate ligands and a unique bidentate ligand structure involving a sulfinyl group. This compound typically exhibits a square planar geometry, which is common for palladium(II) complexes. The presence of the sulfinyl groups contributes to its potential reactivity and stability, while the acetate ligands can influence solubility and interaction with other molecules. The compound may exhibit interesting catalytic properties, particularly in organic synthesis, due to the palladium center's ability to facilitate various reactions, including cross-coupling reactions. Additionally, the specific arrangement of the ligands can affect the electronic properties and sterics of the complex, making it a subject of interest in coordination chemistry and materials science. Overall, this compound exemplifies the diverse chemistry of transition metal complexes and their applications in catalysis and materials development.
Formula:C14H14O2S2·C4H6O4Pd
InChI:InChI=1/C14H16O2S2.2C2H4O2.Pd/c15-17(13-7-3-1-4-8-13)11-12-18(16)14-9-5-2-6-10-14;2*1-2(3)4;/h1-10,17-18H,11-12H2;2*1H3,(H,3,4);/q;;;+2/p-2/rC18H22O6PdS2/c1-15(19)23-25(24-16(2)20)26(21,17-9-5-3-6-10-17)13-14-27(25,22)18-11-7-4-8-12-18/h3-12,26-27H,13-14H2,1-2H3
InChI key:InChIKey=SNNYSJNYZJXIFE-UHFFFAOYSA-L
SMILES:[O-](C(C)=O)[Pd+2]1([O-]C(C)=O)[S](=O)(CC[S]1(=O)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- (SP-4-2)-Bis(acetato-κO)[1,1′-[1,2-ethanediylbis(sulfinyl-κS)]bis[benzene]]palladium
- 1,2-Bis(phenylsulfinyl)ethanepalladium(II)acetate
- Palladium, bis(acetato-κO)[1,1′-[1,2-ethanediylbis(sulfinyl-κS)]bis[benzene]]-, (SP-4-2)-
- White catalyst
- 1,2-Bis(phenylsulfinyl)ethane-palladium diacetate
- 1,2-Bis(phenylsulfinyl)ethane palladium(II) acetate
- 1,2-Bis(phenylsulfinyl)ethanepalladium(II) acetate, min. 98%
- 1,2-Bis(phenylsulfinyl)ethane Palladium(II) Diacetate
- 1,2-Bis(phenylsulfinyl)ethanepalladium(II)acetate,min.98%ChristinaWhiteCatalyst
- 1,2-Bis(phenylsulfinyl)ethanepalladium(II) acetate,Christina White Catalyst,98%
- 1,2-Bis(phenylsulfinyl)ethanepalladiuM(II) acetate,98% Christina White Catalyst
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-Bis(phenylsulfinyl)ethane Palladium(II) Diacetate
CAS:Formula:C18H20O6PdS2Purity:>96.0%(T)Color and Shape:Orange to Amber to Dark red powder to crystalMolecular weight:502.891,2-Bis(phenylsulfinyl)ethanepalladium(II) acetate, min. 98% Christina White Catalyst
CAS:1,2-Bis(phenylsulfinyl)ethanepalladium(II) acetate, min. 98% Christina White Catalyst
Formula:C18H20O6PdS2Purity:min. 98%Color and Shape:orange to brown pwdr.Molecular weight:502.901,2-BIS(PHENYLSULFINYL)ETHANE-PALLADIUM DIACETATE
CAS:Formula:C18H20O6PdS2Purity:97%Color and Shape:SolidMolecular weight:502.89781,2-Bis(Phenylsulfinyl)Ethane Palladium(II) Acetate
CAS:1,2-Bis(Phenylsulfinyl)Ethane Palladium(II) AcetateFormula:C18H20O6PdS2Purity:97%Molecular weight:502.91,2-Bis(phenylsulfinyl)ethane Palladium(II) Diacetate
CAS:1,2-Bis(phenylsulfinyl)ethane Palladium(II) Diacetate is an oxidation catalyst that can be used in the production of detergent compositions. It is synthesized by reacting 1,2-bis(phenylsulfinyl)ethane with palladium acetate in aqueous solution at room temperature. The reaction occurs spontaneously and proceeds through a mechanism involving initial hydrolysis to form the mixed sulfonylchloride and subsequent oxidation to give the mixed sulfonyl-palladate salt. The optimal reaction conditions for this reaction are pH 7, 60°C, and 0.5 equivalents of water vapor. FT-IR spectroscopy has been used to identify the particle size of this catalyst as well as confirm its identity. This catalyst can be used for both stereoselective and non-stereoselective reactions due to its high surface area, which leads to increased reactivity. Other catalysts such asFormula:C18H20O6PdS2Purity:Min. 95%Molecular weight:502.9 g/mol





