CymitQuimica logo

CAS 859964-08-2

:

1,3-Benzenedicarboxylic acid, 5-amino-2-hydroxy-

Description:
1,3-Benzenedicarboxylic acid, 5-amino-2-hydroxy- is an organic compound characterized by its aromatic structure, which includes two carboxylic acid functional groups and an amino group, along with a hydroxyl group. This compound is part of the larger family of benzenedicarboxylic acids, which are known for their applications in various chemical processes and as intermediates in the synthesis of dyes, pharmaceuticals, and polymers. The presence of the amino and hydroxyl groups suggests that it may exhibit properties such as increased solubility in water and potential for hydrogen bonding, which can influence its reactivity and interaction with other substances. Additionally, the specific arrangement of these functional groups can affect its acidity and basicity, making it a candidate for various chemical reactions. The compound's CAS number, 859964-08-2, allows for its identification in chemical databases, facilitating research and application in scientific studies. Overall, this compound's unique structure and functional groups contribute to its potential utility in diverse chemical applications.
Formula:C8H7NO5
InChI:InChI=1S/C8H7NO5/c9-3-1-4(7(11)12)6(10)5(2-3)8(13)14/h1-2,10H,9H2,(H,11,12)(H,13,14)
InChI key:LZWQHDDDGHXOEL-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1C(=O)O)O)C(=O)O)N
Found 7 products.