CymitQuimica logo

CAS 860646-12-4

:

4-Thiazolecarboxylic acid, 2-amino-5-iodo-, ethyl ester

Description:
4-Thiazolecarboxylic acid, 2-amino-5-iodo-, ethyl ester is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group, an amino group, and an ethyl ester moiety, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the iodine atom at the 5-position of the thiazole ring can enhance its biological activity and influence its interaction with biological targets. The compound is likely to exhibit polar characteristics due to the carboxylic acid and amino groups, which can participate in hydrogen bonding. Its solubility in various solvents may vary, depending on the functional groups present. Additionally, the compound may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, given the importance of thiazole derivatives in these fields. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C6H7IN2O2S
InChI:InChI=1S/C6H7IN2O2S/c1-2-11-5(10)3-4(7)12-6(8)9-3/h2H2,1H3,(H2,8,9)
InChI key:InChIKey=KTNLDLYUFMOCFN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(I)SC(N)=N1
Synonyms:
  • 4-Thiazolecarboxylic acid, 2-amino-5-iodo-, ethyl ester
  • Ethyl 2-amino-5-iodothiazole-4-carboxylate
Found 4 products.