CAS 86123-11-7
:Fmoc-D-Tryptophan
Description:
Fmoc-D-Tryptophan is a derivative of the amino acid tryptophan, characterized by the presence of a 9-fluorenylmethoxycarbonyl (Fmoc) protective group. This compound is commonly used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), due to its ability to protect the amino group of tryptophan while allowing for further reactions. Fmoc-D-Tryptophan exhibits properties typical of aromatic amino acids, including the ability to absorb ultraviolet light, which can be useful for monitoring reactions. The presence of the indole side chain contributes to its hydrophobic nature, influencing its solubility and interactions in biological systems. Additionally, the Fmoc group can be removed under mild basic conditions, facilitating the subsequent coupling of amino acids in peptide chains. This compound is often utilized in research and pharmaceutical applications, particularly in the development of peptides with specific biological activities. Its CAS number, 86123-11-7, is a unique identifier that helps in the cataloging and procurement of this chemical substance in various scientific and industrial contexts.
Formula:C26H21N2O4
InChI:InChI=1/C26H22N2O4/c29-25(30)24(13-16-14-27-23-12-6-5-7-17(16)23)28-26(31)32-15-22-20-10-3-1-8-18(20)19-9-2-4-11-21(19)22/h1-12,14,22,24,27H,13,15H2,(H,28,31)(H,29,30)/p-1/t24-/m1/s1
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@H](Cc1c[nH]c2ccccc12)C(=O)[O-])O
Synonyms:- N-alpha-(9-fluorenylmethoxycarbonyl)-D-tryptophan
- Fmoc-D-Trp-OH
- (2R)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-(1H-indol-3-yl)propanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Nα-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-tryptophan
CAS:Formula:C26H22N2O4Purity:>97.0%(T)(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:426.47Fmoc-D-Trp-OH
CAS:Bachem ID: 4003200.
Formula:C26H22N2O4Purity:99.4%Color and Shape:WhitishMolecular weight:426.47Fmoc-D-Trp-OH
CAS:Fmoc-D-Trp-OH is a cinchonidine analog that is synthesized through the coupling of two amino acid molecules, D-Trp and Fmoc-Lys. This compound has been shown to have anti-cancer properties in tumor xenografts, which may be due to its ability to bind hydrogen bonding interactions with proteins. Fmoc-D-Trp-OH also has an anti-inflammatory effect on Alzheimer's disease and cancer cells, which could be due to its ability to inhibit immune cell recruitment and increase apoptosis rates. In addition, it can be used as an optical imaging agent for the detection of brain tumors.Formula:C26H22N2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:426.46 g/molFmoc-D-Trp-OH
CAS:M03377 - Fmoc-D-Trp-OH
Formula:C26H22N2O4Purity:97%Color and Shape:SolidMolecular weight:426.472FMOC-D-Tryptophan extrapure, 99%
CAS:Formula:C26H22N2O4Purity:min. 99%Color and Shape:White, Crystalline powderMolecular weight:426.48







