CymitQuimica logo

CAS 861931-38-6

:

B-[4-Fluoro-2-(methylthio)phenyl]boronic acid

Description:
B-[4-Fluoro-2-(methylthio)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with a fluorine atom and a methylthio group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the fluorine atom can enhance the compound's biological activity and lipophilicity, while the methylthio group may influence its electronic properties and reactivity. Additionally, this compound may exhibit specific interactions with biological targets, making it of interest in drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C7H8BFO2S
InChI:InChI=1S/C7H8BFO2S/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4,10-11H,1H3
InChI key:InChIKey=BAPCTRHEOVOYPW-UHFFFAOYSA-N
SMILES:S(C)C1=C(B(O)O)C=CC(F)=C1
Synonyms:
  • Boronic acid, B-[4-fluoro-2-(methylthio)phenyl]-
  • B-[4-Fluoro-2-(methylthio)phenyl]boronic acid
  • 2-Methylsulfanyl-4-fluorophenylboronic acid
  • Boronic acid, [4-fluoro-2-(methylthio)phenyl]-
  • [4-Fluoro-2-(methylsulfanyl)phenyl]boronic acid
Found 4 products.