CymitQuimica logo

CAS 862574-87-6

:

1-(2,2-Difluoro-2H-1,3-benzodioxol-5-yl)cyclopropane-1-carbonitrile

Description:
1-(2,2-Difluoro-2H-1,3-benzodioxol-5-yl)cyclopropane-1-carbonitrile, with the CAS number 862574-87-6, is a synthetic organic compound characterized by its unique structural features. It contains a cyclopropane ring, which is a three-membered carbon ring known for its strain and reactivity. The presence of a carbonitrile functional group (-C≡N) indicates that it has a cyano group, contributing to its potential reactivity and polarity. The difluorobenzodioxole moiety adds to its complexity, providing both aromatic characteristics and potential for various interactions due to the electronegative fluorine atoms. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its physical properties, such as solubility and melting point, would depend on the specific interactions of its functional groups and overall molecular structure. As with many synthetic compounds, safety and handling precautions should be observed, particularly due to the presence of the cyano group, which can be toxic.
Formula:C11H7F2NO2
InChI:InChI=1S/C11H7F2NO2/c12-11(13)15-8-2-1-7(5-9(8)16-11)10(6-14)3-4-10/h1-2,5H,3-4H2
InChI key:RGKFSYDEMAFDQP-UHFFFAOYSA-N
SMILES:C1CC1(C#N)C2=CC3=C(C=C2)OC(O3)(F)F
Found 6 products.