CAS 863753-30-4

2-(dihydroxyboranyl)anilinium chloride

Description:

2-(Dihydroxyboranyl)anilinium chloride, with the CAS number 863753-30-4, is a chemical compound characterized by the presence of a boron atom bonded to two hydroxyl groups and an anilinium moiety. This compound typically exhibits properties associated with both organic and inorganic chemistry due to the presence of the boron atom, which can participate in coordination chemistry. The anilinium part of the molecule suggests that it may exhibit basic properties, as anilines are known for their ability to accept protons. The chloride ion serves as a counterion, contributing to the compound's solubility in polar solvents. The presence of hydroxyl groups indicates potential for hydrogen bonding, which can influence the compound's physical properties, such as melting point and solubility. Additionally, the compound may exhibit reactivity typical of boron-containing compounds, including the ability to form complexes with various ligands. Overall, 2-(dihydroxyboranyl)anilinium chloride is a unique substance with applications in areas such as materials science and medicinal chemistry.

Formula: C₆H₉BClNO₂

InChI: InChI=1/C6H8BNO2.ClH/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,9-10H,8H2;1H

SMILES: c1ccc(c(c1)B(O)O)N.Cl

Synonyms:

• (2-Aminophenyl)boronic acid hydrochloride (1:1)
• Boronic acid,B-(2-aminophenyl)-,hydrochloride (1:1)
• 2-Aminophenylboronicacidhydrochloride
• 2-Aminophenylboronic acid hydrochloride
• 2-Aminophenylboronic acid HCl
• (2-Aminophenyl)Boronic Acid Hydrochloride

2-Aminobenzeneboronic acid hydrochloride

CAS: 863753-30-4

2-Aminobenzeneboronic acid hydrochloride

Formula: C₆H₈BNO₂·ClH

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 173.40516

Ref: 54-OR10336

2-Aminophenylboronic acid, HCl

CAS: 863753-30-4

Formula: C₆H₉BClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.4052

Ref: IN-DA004PZB

(2-Aminophenyl)boronic acid hydrochloride

CAS: 863753-30-4

(2-Aminophenyl)boronic acid hydrochloride is an analytical reagent that is used in the cross-coupling reaction between aryl bromides and organoboron compounds. It has been synthesized from 2-aminophenylboronic acid, which can be produced by the alkylation of phenol with 3-bromoquinoline. This compound has been shown to have antimalarial activity against the human malaria parasite Plasmodium falciparum in vitro. (2-Aminophenyl)boronic acid hydrochloride has also been shown to have a high intestinal absorption rate when given orally to rats. In vivo studies are needed to determine whether this chemical is safe for humans.

Formula: C₆H₉BClNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 173.41 g/mol

Ref: 3D-FA142951

2-Aminophenylboronic acid, hydrochloride

CAS: 863753-30-4

Formula: C₆H₉BClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 173.4

Ref: 10-F046452