CAS 863774-58-7

5(1H)-Quinazolinone,2,3,4,6,7,8-hexahydro-4-(3-hydroxyphenyl)-7,7-dimethyl-2-thioxo-

Description:

5(1H)-Quinazolinone, 2,3,4,6,7,8-hexahydro-4-(3-hydroxyphenyl)-7,7-dimethyl-2-thioxo- is a complex organic compound characterized by its quinazolinone core structure, which is a bicyclic compound containing a fused benzene and pyrimidine ring. This specific derivative features multiple substituents, including a thioxo group and a hydroxyphenyl moiety, contributing to its potential biological activity. The presence of the hexahydro framework indicates that it has multiple saturated carbon atoms, which may influence its solubility and reactivity. The dimethyl groups suggest steric hindrance, which can affect the compound's interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 863774-58-7, allows for easy identification and retrieval of data related to its synthesis, properties, and potential applications. Overall, the structural complexity and functional groups present in this compound suggest it may have unique chemical behavior and biological significance.

Formula: C₁₆H₁₈N₂O₂S

InChI: InChI=1S/C16H18N2O2S/c1-16(2)7-11-13(12(20)8-16)14(18-15(21)17-11)9-4-3-5-10(19)6-9/h3-6,14,19H,7-8H2,1-2H3,(H2,17,18,21)

InChI key: RUOOPLOUUAYNPY-UHFFFAOYSA-N

SMILES: CC1(CC2=C(C(NC(=S)N2)C3=CC(=CC=C3)O)C(=O)C1)C

Synonyms:

• Dimethylenastron

Dimethylenastron

CAS: 863774-58-7

Formula: C₁₆H₁₈N₂O₂S

Purity: >95.0%(HPLC)

Color and Shape: White to Orange to Green powder to crystal

Molecular weight: 302.39

Ref: 3B-D5812

Dimethylenastron

CAS: 863774-58-7

Dimethylenastron

Formula: C₁₆H₁₈N₂O₂S

Purity: 97.5%

Molecular weight: 302.39

Ref: 54-BUP03623

Dimethylenastron

CAS: 863774-58-7

Dimethylenastron

Formula: C₁₆H₁₈N₂O₂S

Purity: 98+%

Molecular weight: 302.39

Ref: 54-OR1025660

Dimethylenastron

CAS: 863774-58-7

Dimethylenastron, an Eg5 inhibitor, arrests cells with monopolar spindles to which all chromosomes attach in a syntelic manner.

Formula: C₁₆H₁₈N₂O₂S

Purity: 97.81%

Color and Shape: Solid

Molecular weight: 302.39

Ref: TM-T3118

Eg5 Inhibitor III, Dimethylenastron

CAS: 863774-58-7

Dimethylenastron is a novel inhibitor of the mitotic checkpoint. It binds to the inhibitor molecules, which are responsible for maintaining the cell cycle and preventing anaphase. This binding prevents the release of cyclin-dependent kinases (CDKs) from their inhibitory complexes with inhibitors, leading to cell cycle arrest. Dimethylenastron has been shown to be successful in inhibiting tumor growth in cancer cells by inducing apoptosis. Furthermore, this drug has been shown to have a potential diagnostic use in infectious diseases, such as tuberculosis and AIDS.

Formula: C₁₆H₁₈N₂O₂S

Purity: Min. 95%

Molecular weight: 302.39 g/mol

Ref: 3D-NJB77458

Eg5 Inhibitor III, Dimethylenastron

CAS: 863774-58-7

Formula: C₁₆H₁₈N₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 302.3913

Ref: IN-DA008ENL