CymitQuimica logo

CAS 86390-77-4

:

(2S)-2-(acetyloxy)-3-hydroxypropyl (9Z)-octadec-9-enoate

Description:
The chemical substance known as (2S)-2-(acetyloxy)-3-hydroxypropyl (9Z)-octadec-9-enoate, with the CAS number 86390-77-4, is an ester derived from the reaction of a fatty acid and an alcohol. It features a long hydrocarbon chain, characteristic of fatty acid derivatives, which contributes to its hydrophobic properties. The presence of an acetyloxy group indicates that it has an acetyl functional group, which can influence its reactivity and solubility. The (9Z)-octadec-9-enoate portion signifies that it contains a cis double bond in the 9th position of an 18-carbon chain, making it an unsaturated fatty acid derivative. This structure suggests potential applications in biochemistry and pharmaceuticals, particularly in formulations that require emulsification or stabilization. Additionally, the hydroxyl group enhances its polarity, which may improve its solubility in polar solvents. Overall, this compound's unique combination of functional groups and structural features makes it of interest in various chemical and biological contexts.
Formula:C23H42O5
InChI:InChI=1/C23H42O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(26)27-20-22(19-24)28-21(2)25/h10-11,22,24H,3-9,12-20H2,1-2H3/b11-10-/t22-/m0/s1
InChI key:PWTCCMJTPHCGMS-YRBAHSOBSA-N
SMILES:CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](CO)OC(=O)C
Found 9 products.