CymitQuimica logo

CAS 864076-05-1

:

1H-Benzimidazole, 6-iodo-2-methyl-

Description:
1H-Benzimidazole, 6-iodo-2-methyl- is a chemical compound characterized by its benzimidazole core structure, which consists of a fused benzene and imidazole ring. The presence of an iodine atom at the 6-position and a methyl group at the 2-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It is often used in various chemical synthesis processes, particularly in the development of pharmaceuticals and agrochemicals, due to its potential biological activity. The iodine substituent can enhance the compound's reactivity, making it useful in coupling reactions or as a precursor for further functionalization. Additionally, the presence of the methyl group can influence the compound's steric and electronic properties, affecting its interactions in biological systems. As with many halogenated compounds, safety precautions should be taken when handling this substance due to potential toxicity and environmental impact.
Formula:C8H7IN2
InChI:InChI=1S/C6H7BrN2O2/c1-9-3-4(7)8-5(9)6(10)11-2/h3H,1-2H3
InChI key:ROEZBNMDDJUDSC-UHFFFAOYSA-N
SMILES:CN1C=C(N=C1C(=O)OC)Br
Synonyms:
  • 1H-Benzimidazole, 5-iodo-2-methyl-
  • Benzimidazole, 5(or6)-iodo-2-methyl-
  • Benzimidazole, 5-iodo-2-methyl-
  • 5-Iodo-2-Methyl-Benzimidazole
  • 5-Iodo-2-Methyl-1H-Benzo[D]Imidazole
Found 5 products.