CAS 86427-02-3

3-Chlorothiophene-2-carbonyl chloride

Description:

3-Chlorothiophene-2-carbonyl chloride is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. The presence of a carbonyl chloride functional group (–C(=O)Cl) indicates that it is an acyl chloride, making it reactive and useful in various chemical syntheses. The chlorine atom at the 3-position of the thiophene ring contributes to its electrophilic properties, enhancing its reactivity in nucleophilic substitution reactions. This compound is typically used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, as well as in the preparation of other functionalized thiophene derivatives. Its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the compound. Due to the presence of the carbonyl chloride group, it is important to handle this substance with care, as it can release hydrochloric acid upon hydrolysis and may pose health hazards if inhaled or contacted with skin.

Formula: C₅H₂Cl₂OS

InChI: InChI=1/C5H2Cl2OS/c6-3-1-2-9-4(3)5(7)8/h1-2H

SMILES: c1csc(c1Cl)C(=O)Cl

Synonyms:

• 2-Thiophenecarbonyl chloride, 3-chloro-

3-Chlorothiophene-2-carbonyl chloride

CAS: 86427-02-3

3-Chlorothiophene-2-carbonyl chloride

Purity: 95%

Molecular weight: 181.04g/mol

Ref: 54-OR2893

3-Chlorothiophene-2-carbonyl chloride

CAS: 86427-02-3

Formula: C₅H₂Cl₂OS

Purity: 97%

Color and Shape: Solid

Molecular weight: 181.03

Ref: 10-F017408

3-Chlorothiophene-2-carbonylchloride

CAS: 86427-02-3

3-Chlorothiophene-2-carbonylchloride (3C2CC) is a heterobicyclic compound that is a ligand for the amine receptor. It is also used as an intermediate in the synthesis of other heterocycles. 3C2CC has been shown to interact with amines to form a nitrene, which can be detected by luminescence or x-ray diffraction techniques. 3C2CC interacts with chloride ions to form a crystal that has a different x-ray diffraction pattern from the one obtained from chloride alone. The crystal structure of this complex was determined using x-ray crystallography.

Formula: C₅H₂Cl₂OS

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 181.04 g/mol

Ref: 3D-FC149697