CymitQuimica logo

CAS 86427-02-3

:

3-Chlorothiophene-2-carbonyl chloride

Description:
3-Chlorothiophene-2-carbonyl chloride is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. The presence of a carbonyl chloride functional group (–C(=O)Cl) indicates that it is an acyl chloride, making it reactive and useful in various chemical syntheses. The chlorine atom at the 3-position of the thiophene ring contributes to its electrophilic properties, enhancing its reactivity in nucleophilic substitution reactions. This compound is typically used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, as well as in the preparation of other functionalized thiophene derivatives. Its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the compound. Due to the presence of the carbonyl chloride group, it is important to handle this substance with care, as it can release hydrochloric acid upon hydrolysis and may pose health hazards if inhaled or contacted with skin.
Formula:C5H2Cl2OS
InChI:InChI=1/C5H2Cl2OS/c6-3-1-2-9-4(3)5(7)8/h1-2H
InChI key:GCPHKTQMABHWPY-UHFFFAOYSA-N
SMILES:c1csc(c1Cl)C(=O)Cl
Synonyms:
  • 2-Thiophenecarbonyl chloride, 3-chloro-
Found 6 products.