CAS 86445-22-9

Auxinole

Description:

Auxinole, with the CAS number 86445-22-9, is a chemical compound that belongs to the class of auxins, which are plant hormones that play a crucial role in regulating various aspects of plant growth and development. Characteristically, auxins are known for their involvement in processes such as cell elongation, apical dominance, and root formation. Auxinole may exhibit properties typical of auxins, including the ability to influence cell division and differentiation. It is often utilized in agricultural practices to promote root growth in cuttings and enhance fruit development. The compound's structure typically includes a carboxylic acid functional group, which is essential for its biological activity. Additionally, auxins like Auxinole can interact with specific receptors in plant cells, triggering signaling pathways that lead to physiological changes. While specific physical and chemical properties such as solubility, melting point, and stability may vary, they are generally consistent with those of other auxin compounds. Overall, Auxinole serves as an important tool in plant biology and agricultural applications.

Formula: C₂₀H₁₉NO₃

InChI: InChI=1S/C20H19NO3/c1-12-7-8-14(13(2)9-12)19(22)10-16(20(23)24)17-11-21-18-6-4-3-5-15(17)18/h3-9,11,16,21H,10H2,1-2H3,(H,23,24)

InChI key: HGUYAIJBXSQXGV-UHFFFAOYSA-N

SMILES: CC1=CC(=C(C=C1)C(=O)CC(C2=CNC3=CC=CC=C32)C(=O)O)C

Synonyms:

• Auxinole
• 1H-Indole-3-acetic acid, α-[2-(2,4-dimethylphenyl)-2-oxoethyl]-

Auxinole

CAS: 86445-22-9

Auxinole, a potent antagonist of TIR1/AFB auxin receptors, effectively binds to TIR1, inhibiting the formation of the TIR1-IAA-Aux/IAA complex.

Formula: C₂₀H₁₉NO₃

Purity: 98.69%

Color and Shape: White Solid

Molecular weight: 321.3698

Ref: TM-T14353

Auxinole

CAS: 86445-22-9

Auxinole

Formula: C₂₀H₁₉NO₃

Purity: 98.5%

Molecular weight: 321.37

Ref: 54-BUP12692

Auxinole

CAS: 86445-22-9

Auxinole

Formula: C₂₀H₁₉NO₃

Purity: ≥98%

Molecular weight: 321.37

Ref: 54-OR1023316

4-(2,4-Dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid

CAS: 86445-22-9

Formula: C₂₀H₁₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 321.3698

Ref: IN-DA01E5JP

Auxinole

CAS: 86445-22-9

4-(2,4-Dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid

Formula: C₂₀H₁₉NO₃

Purity: 98%

Molecular weight: 321.37

Ref: IN-DG00777289

4-(2,4-Dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid

CAS: 86445-22-9

Purity: 98%

Molecular weight: 321.3760071

Ref: 10-F867091

Auxinole

Controlled Product

CAS: 86445-22-9

Applications Auxinole is a phytohormone which acts as an auxin antagonist.
References Hayashi,K-I., et al.: ACS Chem. Biol., 7, 590-598 (2012)

Formula: C₂₀H₁₉NO₃

Color and Shape: Neat

Molecular weight: 321.37

Ref: TR-A794595