CymitQuimica logo

CAS 864754-16-5

:

Ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-acetate

Description:
Ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-acetate is an organic compound characterized by its unique structure, which includes a pyrazole ring and a dioxaborolane moiety. The presence of the ethyl acetate group contributes to its ester functionality, making it potentially useful in various chemical reactions, particularly in organic synthesis and medicinal chemistry. The dioxaborolane component is known for its ability to participate in boron chemistry, which can facilitate reactions such as cross-coupling and serve as a boron source in various transformations. This compound may exhibit specific solubility properties, depending on the solvent used, and could have applications in agrochemicals or pharmaceuticals due to its structural features. Additionally, the presence of multiple methyl groups enhances its steric properties, which can influence its reactivity and interactions with other molecules. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C13H21BN2O4
InChI:InChI=1S/C13H21BN2O4/c1-6-18-11(17)9-16-8-10(7-15-16)14-19-12(2,3)13(4,5)20-14/h7-8H,6,9H2,1-5H3
InChI key:InChIKey=YUEZJHOSHBTWPV-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CN(CC(OCC)=O)N=C2
Synonyms:
  • 1-(Ethoxycarbonylmethyl)-1H-Pyrazole-4-Boronic Acid, Pinacol Ester
  • 1-(Ethoxycarbonylmethyl)pyrazole-4-boronic acid pinacol ester
  • 1H-Pyrazole-1-acetic acid, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester
  • Ethyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)acetate
  • Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetate
  • Ethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-acetate
Found 4 products.