CymitQuimica logo

CAS 864754-37-0

:

Thiomorpholine,4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl]-

Description:
Thiomorpholine, 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonyl]- is a chemical compound characterized by its unique structural features, including a thiomorpholine ring and a sulfonyl group attached to a phenyl moiety that is further substituted with a boron-containing dioxaborolane. The presence of the thiomorpholine ring imparts properties typical of heterocyclic compounds, such as potential nucleophilicity and the ability to participate in various chemical reactions. The dioxaborolane moiety is known for its utility in organic synthesis, particularly in cross-coupling reactions and as a boron source in various transformations. This compound may exhibit biological activity due to its complex structure, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can be influenced by the functional groups present, which may also affect its interactions in biological systems. Overall, this compound represents a blend of organic and organoboron chemistry, with potential applications in pharmaceuticals and materials science.
Formula:C16H24BNO4S2
InChI:InChI=1S/C16H24BNO4S2/c1-15(2)16(3,4)22-17(21-15)13-6-5-7-14(12-13)24(19,20)18-8-10-23-11-9-18/h5-7,12H,8-11H2,1-4H3
InChI key:ZLQWSRKDPDXSKJ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)N3CCSCC3
Synonyms:
  • 4-[3-(4,4,5,5-Tetramethyl-[1,3,2]Dioxaborolan-2-Yl)-Benzenesulfonyl]-Thiomorpholine
  • 3-(Thiomorpholinosulfonyl)Phenylboronic Acid Pinacol Ester
Found 5 products.