CymitQuimica logo

CAS 865186-94-3

:

5-Chloropyridine-3-boronic acid pinacol ester

Description:
5-Chloropyridine-3-boronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid moiety and a chlorinated pyridine ring. This compound typically features a boron atom bonded to a pinacol ester, which enhances its stability and solubility in organic solvents. The chloropyridine structure contributes to its reactivity, particularly in cross-coupling reactions, making it valuable in synthetic organic chemistry for the formation of carbon-carbon bonds. The presence of the boronic acid functionality allows for participation in Suzuki-Miyaura coupling reactions, which are widely used in the synthesis of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit moderate to high polarity due to the boron and chlorine substituents, influencing its interactions with other chemical species. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Overall, 5-Chloropyridine-3-boronic acid pinacol ester is a versatile intermediate in organic synthesis, particularly in the development of complex molecular architectures.
Formula:C11H15BClNO2
InChI:InChI=1/C11H15BClNO2/c1-10(2)11(3,4)16-12(15-10)8-5-9(13)7-14-6-8/h5-7H,1-4H3
InChI key:WCKBNAJTZUVHPD-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2cc(cnc2)Cl)O1
Synonyms:
  • 3-Chloro-5-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Pyridine
Found 5 products.