CymitQuimica logo

CAS 865352-01-8

:

2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzene-1-sulfonyl chloride

Description:
2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzene-1-sulfonyl chloride is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with both a trifluoromethyl group and a sulfonyl chloride functional group. The presence of the sulfonyl chloride group indicates that this compound is likely reactive, particularly towards nucleophiles, making it useful in various synthetic applications. The difluoroethoxy moiety contributes to its overall polarity and may influence its solubility in organic solvents. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. Its fluorinated groups enhance its stability and can impart unique electronic properties, which may be beneficial in specific chemical reactions. Safety precautions are necessary when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture.
Formula:C7H3ClF5O3S
InChI:InChI=1S/C9H6ClF5O3S/c10-19(16,17)8-5(9(13,14)15)2-1-3-6(8)18-4-7(11)12/h1-3,7H,4H2
InChI key:DTNQLYAGRKNWMQ-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)OCC(F)F)S(=O)(=O)Cl)C(F)(F)F
Synonyms:
  • Benzenesulfonyl chloride, 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)-
Found 4 products.