CymitQuimica logo

CAS 866081-62-1

:

tert-butyl-[3-(tert-butyl-methyl-phosphanyl)quinoxalin-2-yl]-methyl-phosphane

Description:
Tert-butyl-[3-(tert-butyl-methyl-phosphanyl)quinoxalin-2-yl]-methyl-phosphane is a phosphane compound characterized by the presence of a quinoxaline moiety and multiple tert-butyl groups. This compound features a phosphanyl group, which is known for its ability to act as a ligand in coordination chemistry, often forming complexes with transition metals. The tert-butyl groups contribute to the steric bulk of the molecule, influencing its reactivity and solubility. The quinoxaline structure provides potential for various applications in organic synthesis and materials science due to its aromatic nature and ability to participate in π-π stacking interactions. Additionally, the presence of phosphorus in the structure may impart unique electronic properties, making it of interest in catalysis and the development of new materials. Overall, this compound exemplifies the intersection of organic and inorganic chemistry, showcasing the versatility of phosphane ligands in various chemical contexts.
Formula:C18H28N2P2
InChI:InChI=1/C18H28N2P2/c1-17(2,3)21(7)15-16(22(8)18(4,5)6)20-14-12-10-9-11-13(14)19-15/h9-12H,1-8H3
InChI key:DRZBLHZZDMCPGX-VXKWHMMOSA-N
SMILES:CC(C)(C)P(C)c1c(nc2ccccc2n1)P(C)C(C)(C)C
Found 6 products.