CymitQuimica logo

CAS 86661-32-7

:

(S)-tert-Butyl 2-(tosyloxymethyl)pyrrolidine-1-carboxylate

Description:
(S)-tert-Butyl 2-(tosyloxymethyl)pyrrolidine-1-carboxylate, with the CAS number 86661-32-7, is a chiral compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is characterized by the presence of a tert-butyl group and a tosyl (tosyloxy) moiety. The tosyl group enhances the compound's reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, including esterification and nucleophilic substitution. The chirality of the compound suggests that it may exhibit specific biological activity, making it of interest in pharmaceutical research. Additionally, its solubility and stability in organic solvents can facilitate its use in laboratory settings. Overall, this compound is significant for its potential applications in the synthesis of more complex molecules and its role in the development of new therapeutic agents.
Formula:C17H25NO5S
InChI:InChI=1/C17H25NO5S/c1-13-7-9-15(10-8-13)24(20,21)22-12-14-6-5-11-18(14)16(19)23-17(2,3)4/h7-10,14H,5-6,11-12H2,1-4H3/t14-/m0/s1
InChI key:VSVOPDINJSHSBZ-AWEZNQCLSA-N
SMILES:Cc1ccc(cc1)S(=O)(=O)OC[C@@H]1CCCN1C(=O)OC(C)(C)C
Synonyms:
  • 1-pyrrolidinecarboxylic acid, 2-[[[(4-methylphenyl)sulfonyl]oxy]methyl]-, 1,1-dimethylethyl ester, (2S)-
  • tert-Butyl-(2S)-2-({[(4-methylphenyl)sulfonyl]oxy}methyl)pyrrolidin-1-carboxylat
  • tert-butyl (2S)-2-({[(4-methylphenyl)sulfonyl]oxy}methyl)pyrrolidine-1-carboxylate
Found 3 products.