CAS 86770-67-4

2-{2-[2-(2-azidoethoxy)ethoxy]ethoxy}ethanol

Description:

2-{2-[2-(2-azidoethoxy)ethoxy]ethoxy}ethanol, with the CAS number 86770-67-4, is a chemical compound characterized by its complex ether structure, which includes multiple ethoxy groups and an azido functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents such as water and alcohols due to the presence of hydroxyl and ether functionalities, which enhance its hydrophilicity. The azido group (-N3) is notable for its reactivity, particularly in click chemistry applications, making this compound useful in synthetic organic chemistry for the development of various materials and bioconjugates. Additionally, the presence of multiple ether linkages contributes to its potential as a polymer precursor or in the formulation of surfactants. Safety considerations should be taken into account due to the azido group, which can be explosive under certain conditions. Overall, this compound serves as a versatile building block in chemical synthesis and materials science.

Formula: C₈H₁₇N₃O₄

InChI: InChI=1/C8H17N3O4/c9-11-10-1-3-13-5-7-15-8-6-14-4-2-12/h12H,1-8H2

SMILES: C(COCCOCCOCCO)N=[N+]=[NH-]

11-Azido-3,6,9-trioxaundecanol

CAS: 86770-67-4

Formula: C₈H₁₇N₃O₄

Purity: >97.0%(GC)

Color and Shape: Colorless to Yellow clear liquid

Molecular weight: 219.24

Ref: 3B-A2294

Ethanol,2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-

CAS: 86770-67-4

Formula: C₈H₁₇N₃O₄

Purity: 97%

Color and Shape: Liquid

Molecular weight: 219.2383

Ref: IN-DA004SB6

Azido-PEG4-alcohol

CAS: 86770-67-4

Azido-PEG4-alcohol

Formula: C₈H₁₇N₃O₄

Purity: By hplc: 98.2% (Typical Value in Batch COA)

Color and Shape: light yellow oil

Molecular weight: 219.24g/mol

Ref: 54-BIPG1117

PEG4-azide

Controlled Product

CAS: 86770-67-4

Applications 1-Azido-3,6,9-trioxaundecane-11-ol (cas# 86770-67-4) is a compound useful in organic synthesis.
References Hatch, D., et al.: ChemBioChem., 9, 2433 (2008),

Formula: C₈H₁₇N₃O₄

Color and Shape: Neat

Molecular weight: 219.24

Ref: TR-A885250

1-(diazyn-1-ium-1-yl)-12-hydroxy-4,7,10-trioxa-1-azadodecan-1-ide

CAS: 86770-67-4

Purity: 97%

Molecular weight: 219.2409973

Ref: 10-F875647

Azido-PEG4-alcohol

CAS: 86770-67-4

Azido-PEG4-alcohol is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.

Formula: C₈H₁₇N₃O₄

Color and Shape: Pale Yellow Oil

Molecular weight: 219.24

Ref: TM-T14438

Azido-dPEG®4-Alcohol

CAS: 86770-67-4

Azido-dPEG®4-Alcohol is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, azido-dPEG®4-Alcohol is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.

Purity: Min. 95%

Molecular weight: 219.24 g/mol

Ref: 3D-DPG-5786

2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethanol

CAS: 86770-67-4

2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethanol is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanol is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.

Formula: C₈H₁₇N₃O₄

Purity: Min. 95%

Color and Shape: Colorless Powder

Molecular weight: 219.24 g/mol

Ref: 3D-FA09300