CAS 86770-67-4
:2-{2-[2-(2-azidoethoxy)ethoxy]ethoxy}ethanol
Description:
2-{2-[2-(2-azidoethoxy)ethoxy]ethoxy}ethanol, with the CAS number 86770-67-4, is a chemical compound characterized by its complex ether structure, which includes multiple ethoxy groups and an azido functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents such as water and alcohols due to the presence of hydroxyl and ether functionalities, which enhance its hydrophilicity. The azido group (-N3) is notable for its reactivity, particularly in click chemistry applications, making this compound useful in synthetic organic chemistry for the development of various materials and bioconjugates. Additionally, the presence of multiple ether linkages contributes to its potential as a polymer precursor or in the formulation of surfactants. Safety considerations should be taken into account due to the azido group, which can be explosive under certain conditions. Overall, this compound serves as a versatile building block in chemical synthesis and materials science.
Formula:C8H17N3O4
InChI:InChI=1/C8H17N3O4/c9-11-10-1-3-13-5-7-15-8-6-14-4-2-12/h12H,1-8H2
SMILES:C(COCCOCCOCCO)N=[N+]=[NH-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
11-Azido-3,6,9-trioxaundecanol
CAS:Formula:C8H17N3O4Purity:>97.0%(GC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:219.24Ethanol,2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-
CAS:Formula:C8H17N3O4Purity:95%Color and Shape:LiquidMolecular weight:219.2383Ref: IN-DA004SB6
100gTo inquire250mg28.00€1g40.00€5g96.00€10g145.00€25g245.00€50g590.00€500g1,529.00€1kg2,503.00€Azido-PEG4-alcohol
CAS:Azido-PEG4-alcoholFormula:C8H17N3O4Purity:By hplc: 98.2% (Typical Value in Batch COA)Color and Shape:Pale yellow LiquidMolecular weight:219.23828Azido-PEG4-alcohol
CAS:11-Azido-3,6,9-trioxaundecanolFormula:C8H17N3O4Purity:97%Molecular weight:219.24PEG4-azide
CAS:Controlled ProductApplications 1-Azido-3,6,9-trioxaundecane-11-ol (cas# 86770-67-4) is a compound useful in organic synthesis.
References Hatch, D., et al.: ChemBioChem., 9, 2433 (2008),Formula:C8H17N3O4Color and Shape:NeatMolecular weight:219.241-(diazyn-1-ium-1-yl)-12-hydroxy-4,7,10-trioxa-1-azadodecan-1-ide
CAS:Purity:97%Molecular weight:219.2409973Azido-PEG4-alcohol
CAS:Azido-PEG4-alcohol is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C8H17N3O4Color and Shape:SolidMolecular weight:219.24Azido-dPEG®4-Alcohol
CAS:Azido-dPEG®4-Alcohol is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, azido-dPEG®4-Alcohol is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.Purity:Min. 95%Molecular weight:219.24 g/mol2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethanol
CAS:2-[2-[2-(2-Azidoethoxy)ethoxy]ethoxy]ethanol is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethanol is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.
Formula:C8H17N3O4Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:219.24 g/mol







