CymitQuimica logo

CAS 868271-13-0

:

5-Fluoro-1,2-benzoxazol-3-amine

Description:
5-Fluoro-1,2-benzoxazol-3-amine is a chemical compound characterized by its unique structure, which includes a benzoxazole ring fused with an amino group and a fluorine atom. This compound typically exhibits properties associated with heterocyclic aromatic amines, including potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. It is often used in medicinal chemistry and research due to its potential as a pharmacophore in drug development. The compound may exhibit solubility in organic solvents and varying degrees of stability under different conditions. Its reactivity can be influenced by the amino group, which can participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the compound's properties may be further explored through its interactions with other chemical entities, making it of interest in the fields of organic synthesis and pharmaceutical research. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C7H5FN2O
InChI:InChI=1/C7H5FN2O/c8-4-1-2-6-5(3-4)7(9)10-11-6/h1-3H,(H2,9,10)
InChI key:MBKJAWUGNSKUIU-UHFFFAOYSA-N
SMILES:c1cc2c(cc1F)c(=N)[nH]o2
Synonyms:
  • 1,2-Benzisoxazol-3-amine, 5-fluoro-
  • 5-Fluoro-1,2-Benzisoxazol-3-amine
Found 4 products.