CymitQuimica logo

CAS 868406-71-7

:

methyl 4-amino-5-bromo-2-chlorobenzoate

Description:
Methyl 4-amino-5-bromo-2-chlorobenzoate, with the CAS number 868406-71-7, is an organic compound that belongs to the class of benzoate esters. It features a benzoic acid derivative where a methyl ester group is attached to the carboxylic acid, along with amino, bromo, and chloro substituents on the aromatic ring. The presence of the amino group indicates potential basic properties, while the halogen substituents (bromo and chloro) can influence the compound's reactivity and polarity. This compound may exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic structure. Its unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the presence of halogens can enhance its biological activity or alter its interaction with biological systems. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity or environmental impact.
Formula:C8H7BrClNO2
InChI:InChI=1S/C8H7BrClNO2/c1-13-8(12)4-2-5(9)7(11)3-6(4)10/h2-3H,11H2,1H3
InChI key:BRWMPJAKIUAACC-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=C(C=C1Cl)N)Br
Found 4 products.