CymitQuimica logo

CAS 868668-58-0

:

8-Methyl-5-(trifluoromethyl)quinoline

Description:
8-Methyl-5-(trifluoromethyl)quinoline is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure that includes a benzene ring and a pyridine ring. The presence of a methyl group at the 8-position and a trifluoromethyl group at the 5-position significantly influences its chemical properties and reactivity. This compound is typically a pale yellow to light brown solid, exhibiting moderate solubility in organic solvents. Its trifluoromethyl group enhances lipophilicity and can impart unique electronic properties, making it of interest in medicinal chemistry and material science. The compound may exhibit biological activity, potentially serving as a scaffold for drug development. Additionally, its structural features may contribute to its utility in various chemical reactions, including electrophilic substitutions and coupling reactions. Safety data should be consulted for handling, as the trifluoromethyl group can affect toxicity and environmental impact. Overall, 8-Methyl-5-(trifluoromethyl)quinoline is a versatile compound with potential applications in various fields of chemistry.
Formula:C11H8F3N
InChI:InChI=1S/C11H8F3N/c1-7-4-5-9(11(12,13)14)8-3-2-6-15-10(7)8/h2-6H,1H3
InChI key:MHMJNBHDCKQLKY-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(C=C1)C(F)(F)F)C=CC=N2
Found 1 products.