CAS 86945-25-7
:Aminoethylbenzylpiperidine
Description:
Aminoethylbenzylpiperidine, identified by its CAS number 86945-25-7, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is substituted with an aminoethyl group and a benzyl group. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound is typically characterized by its molecular weight, solubility in various solvents, and specific reactivity patterns due to the presence of functional groups. It may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring and the amino group, which can participate in hydrogen bonding. The compound's characteristics, including its melting point, boiling point, and spectral data (such as NMR and IR), are essential for its identification and application in research. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information.
Formula:C14H22N2
InChI:InChI=1/C14H22N2/c15-9-6-13-7-10-16(11-8-13)12-14-4-2-1-3-5-14/h1-5,13H,6-12,15H2
SMILES:c1ccc(cc1)CN1CCC(CCN)CC1
Synonyms:- 4-(2-Aminoethyl)-1-benzylpiperidine
- 2-(1-Benzylpiperidin-4-Yl)Ethanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(2-Aminoethyl)-1-benzylpiperidine
CAS:Formula:C14H22N2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:218.342-(1-benzylpiperidin-4-yl)ethan-1-amine
CAS:2-(1-benzylpiperidin-4-yl)ethan-1-amineFormula:C14H22N2Purity:98%Molecular weight:218.3442-(1-Benzylpiperidin-4-yl)ethanamine
CAS:Formula:C14H22N2Purity:98%Color and Shape:LiquidMolecular weight:218.33792-(1-Benzylpiperidin-4-yl)ethanamine
CAS:Formula:C14H22N2Purity:98%Color and Shape:Liquid, ClearMolecular weight:218.3442-(1-Benzylpiperidin-4-yl)ethanamine
CAS:2-(1-Benzylpiperidin-4-yl)ethanamine is a linker that has been shown to have neuroprotective, antioxidant, and anti-inflammatory properties. It can be used as an innovative drug for the treatment of Alzheimer's disease and other neurological disorders. 2-(1-Benzylpiperidin-4-yl)ethanamine has been shown to exhibit significant antioxidant activity in biochemical assays and molecular modeling. This compound interacts with a number of proteins involved in oxidative stress including NADPH oxidases, peroxiredoxins, catalases, glutathione reductase, cytochrome p450s, mycobacterium tuberculosis protein ESX1 secretion system protein (ESX1), and thioredoxin reductase 1.
Formula:C14H22N2Purity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:218.34 g/mol




