CymitQuimica logo

CAS 869951-10-0

:

methyl {2-[(chloroacetyl)amino]-1,3-thiazol-5-yl}acetate

Description:
Methyl {2-[(chloroacetyl)amino]-1,3-thiazol-5-yl}acetate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a chloroacetyl group, which contributes to its reactivity and potential biological activity. The presence of the methyl ester group indicates that it can undergo hydrolysis to release the corresponding acid, which may have implications for its solubility and reactivity in various environments. The thiazole moiety is often associated with various pharmacological properties, making this compound of interest in medicinal chemistry. Its CAS number, 869951-10-0, allows for precise identification in chemical databases. Overall, this compound's unique structure suggests potential applications in drug development, particularly in targeting specific biological pathways or as a precursor for synthesizing more complex molecules. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C8H9ClN2O3S
InChI:InChI=1/C8H9ClN2O3S/c1-14-7(13)2-5-4-10-8(15-5)11-6(12)3-9/h4H,2-3H2,1H3,(H,10,11,12)
SMILES:COC(=O)Cc1cnc(N=C(CCl)O)s1
Synonyms:
  • 5-Thiazoleacetic Acid, 2-[(2-Chloroacetyl)Amino]-, Methyl Ester
Found 1 products.