CymitQuimica logo

CAS 870089-49-9

:

1-Boc-3-acetyl-azetidine

Description:
1-Boc-3-acetyl-azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group for amines, indicating that the nitrogen in the azetidine is protected to prevent unwanted reactions during synthetic processes. The acetyl group attached at the 3-position of the azetidine ring introduces a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules, due to its ability to serve as a building block or intermediate. Its properties, such as solubility and reactivity, can be influenced by the presence of the Boc and acetyl groups, making it a versatile compound in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, to ensure safe laboratory practices.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-7(12)8-5-11(6-8)9(13)14-10(2,3)4/h8H,5-6H2,1-4H3
InChI key:InChIKey=KRFZYPWUCOYOML-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(C(C)=O)C1
Found 4 products.