CymitQuimica logo

CAS 870135-17-4

:

4-Chloro-1,6-dimethyl-1H-imidazo[4,5-c]pyridine

Description:
4-Chloro-1,6-dimethyl-1H-imidazo[4,5-c]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings. This compound features a chlorine atom and two methyl groups attached to the imidazole ring, which contribute to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the chlorine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The compound is of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its structure allows for interactions with biological targets, which may lead to therapeutic applications. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 4-Chloro-1,6-dimethyl-1H-imidazo[4,5-c]pyridine is a significant compound in research, particularly in the fields of organic synthesis and drug discovery.
Formula:C8H8ClN3
InChI:InChI=1S/C8H8ClN3/c1-5-3-6-7(8(9)11-5)10-4-12(6)2/h3-4H,1-2H3
InChI key:InChIKey=DNZYJLFFCZVGRL-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(C)=N1)N(C)C=N2
Synonyms:
  • 4-Chloro-1,6-Dimethyl-1H-Imidazo[4,5-C]Pyridine
  • 1H-Imidazo[4,5-c]pyridine, 4-chloro-1,6-dimethyl-
Found 4 products.