CymitQuimica logo

CAS 87050-61-1

:

Benzenemethanol, 4-bromo-2,5-dimethoxy-

Description:
Benzenemethanol, 4-bromo-2,5-dimethoxy- is an organic compound characterized by its aromatic structure and the presence of both bromine and methoxy functional groups. The compound features a benzene ring substituted with a bromine atom at the para position and two methoxy groups at the 2 and 5 positions. This substitution pattern influences its chemical reactivity and physical properties, such as solubility and boiling point. The methoxy groups are electron-donating, which can enhance the nucleophilicity of the aromatic ring, making it more reactive towards electrophiles. The presence of the bromine atom introduces a halogen, which can participate in various chemical reactions, including nucleophilic substitution and cross-coupling reactions. Additionally, the compound may exhibit interesting biological activities due to its structural features. It is important to handle this substance with care, as it may pose health risks, and proper safety protocols should be followed during its use in laboratory settings.
Formula:C9H11BrO3
InChI:InChI=1S/C9H11BrO3/c1-12-8-4-7(10)9(13-2)3-6(8)5-11/h3-4,11H,5H2,1-2H3
InChI key:FBDDSLYEUYOKFL-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C=C1CO)OC)Br
Found 2 products.