CAS 87075-33-0
:4-[2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-yl hydrogen sulfate
Description:
4-[2-Hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-yl hydrogen sulfate, with the CAS number 87075-33-0, is a chemical compound characterized by its complex structure, which includes a naphthalene moiety and a sulfate group. This compound features a hydroxy group and an isopropylamino side chain, contributing to its potential biological activity. It is typically a white to off-white solid, soluble in polar solvents due to the presence of the sulfate and hydroxy functional groups. The presence of the naphthalene ring suggests potential aromatic properties, which may influence its reactivity and interactions in various chemical environments. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature, making it important to consider these factors in practical applications. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C16H21NO6S
InChI:InChI=1/C16H21NO6S/c1-11(2)17-9-12(18)10-22-15-7-8-16(23-24(19,20)21)14-6-4-3-5-13(14)15/h3-8,11-12,17-18H,9-10H2,1-2H3,(H,19,20,21)
SMILES:CC(C)NCC(COc1ccc(c2ccccc12)OS(=O)(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4-Hydroxy Propranolol Sulphate
CAS:Formula:C16H21NO6SColor and Shape:Off-White SolidMolecular weight:355.41rac 4-Sulfoxy Propranolol-d7 Sodium Salt
CAS:Controlled ProductApplications A major non-β-blocking propranolol metabolite in man.
References Fitzgerald, J.D., et al.: J. Pharmacol., 43, 222 (1971), Hoffmann, K.-J., et al.: Drug. Metab. Dispos., 10, 173, 1982Formula:C16H13D7NNaO6SColor and Shape:NeatMolecular weight:384.43


