CymitQuimica logo

CAS 870822-79-0

:

B-[3-Chloro-4-(trifluoromethoxy)phenyl]boronic acid

Description:
B-[3-Chloro-4-(trifluoromethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. The compound features a chlorinated phenyl ring and a trifluoromethoxy group, which can enhance its reactivity and solubility in organic solvents. The trifluoromethoxy group is notable for its electron-withdrawing properties, which can influence the electronic characteristics of the molecule, potentially affecting its reactivity and interactions with other chemical species. This compound is often utilized in medicinal chemistry and materials science for the development of pharmaceuticals and advanced materials. Its boronic acid functionality allows for the formation of stable complexes with biomolecules, making it a valuable tool in chemical biology. As with many organoboron compounds, it should be handled with care, considering its potential reactivity and the need for proper safety protocols in laboratory settings.
Formula:C7H5BClF3O3
InChI:InChI=1S/C7H5BClF3O3/c9-5-3-4(8(13)14)1-2-6(5)15-7(10,11)12/h1-3,13-14H
InChI key:InChIKey=LNHZFDNECMPGHG-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(Cl)C=C(B(O)O)C=C1
Synonyms:
  • B-[3-Chloro-4-(trifluoromethoxy)phenyl]boronic acid
  • Boronic acid, [3-chloro-4-(trifluoromethoxy)phenyl]-
  • Boronicacid, [3-chloro-4-(trifluoromethoxy)phenyl]- (9CI)
  • [3-Chloro-4-(trifluoromethoxy)phenyl]boronic acid
  • Boronic acid, B-[3-chloro-4-(trifluoromethoxy)phenyl]-
Found 5 products.