CymitQuimica logo

CAS 870842-23-2

:

tert-butyl 3-oxoazepane-1-carboxylate

Description:
Tert-butyl 3-oxoazepane-1-carboxylate is an organic compound characterized by its azepane ring structure, which is a seven-membered cyclic amine. This compound features a tert-butyl group, contributing to its hydrophobic properties, and a carboxylate functional group, which enhances its reactivity and solubility in polar solvents. The presence of the keto group (3-oxo) indicates that it has a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. The molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its stability and reactivity can be influenced by the steric hindrance provided by the tert-butyl group, making it a useful intermediate in synthetic chemistry. Additionally, the compound's properties, such as boiling point, melting point, and solubility, would depend on the specific conditions and the presence of other functional groups in the molecule. Overall, tert-butyl 3-oxoazepane-1-carboxylate is a versatile compound with significant potential in various chemical applications.
Formula:C11H19NO3
InChI:InChI=1/C11H19NO3/c1-11(2,3)15-10(14)12-7-5-4-6-9(13)8-12/h4-8H2,1-3H3
InChI key:HMWANNJNYUPZPN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCCC(=O)C1
Synonyms:
  • tert-Butyl 3-oxoazepane-1-carboxylate
Found 4 products.