CymitQuimica logo

CAS 871113-19-8

:

4-(2-fluorophenyl)piperidin-4-ol

Description:
4-(2-Fluorophenyl)piperidin-4-ol is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a fluorophenyl group at the 4-position of the piperidine ring introduces unique electronic and steric properties, influencing its reactivity and potential biological activity. This compound features a hydroxyl (-OH) group at the 4-position of the piperidine, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The fluorine atom on the phenyl ring can affect the compound's lipophilicity and metabolic stability, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure suggests potential applications in the treatment of various conditions, possibly including neurological disorders, due to the piperidine framework's prevalence in psychoactive substances. As with many chemical substances, safety and handling precautions should be observed, and its properties should be evaluated in the context of specific applications or research.
Formula:C11H14FNO
InChI:InChI=1S/C11H14FNO/c12-10-4-2-1-3-9(10)11(14)5-7-13-8-6-11/h1-4,13-14H,5-8H2
InChI key:CZSXGDMJPLTNTC-UHFFFAOYSA-N
SMILES:C1CNCCC1(C2=CC=CC=C2F)O
Found 3 products.