CymitQuimica logo

CAS 871126-29-3

:

B-[2-[[4-(2-Methoxyethyl)phenoxy]methyl]phenyl]boronic acid

Description:
B-[2-[[4-(2-Methoxyethyl)phenoxy]methyl]phenyl]boronic acid, identified by its CAS number 871126-29-3, is an organoboron compound characterized by the presence of a boronic acid functional group. This compound typically exhibits properties such as moderate solubility in polar organic solvents due to its phenolic structure and the presence of the methoxyethyl group, which can enhance its solubility and reactivity. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in various applications, including organic synthesis and medicinal chemistry. The specific structure of this compound suggests potential utility in drug development, particularly in the design of inhibitors for certain biological targets. Additionally, the presence of the phenoxy and methoxyethyl substituents may influence its electronic properties and steric hindrance, affecting its reactivity and interaction with biological molecules. Overall, this compound represents a versatile building block in the field of organic chemistry and pharmaceutical research.
Formula:C16H19BO4
InChI:InChI=1S/C16H19BO4/c1-20-11-10-13-6-8-15(9-7-13)21-12-14-4-2-3-5-16(14)17(18)19/h2-9,18-19H,10-12H2,1H3
InChI key:InChIKey=AIHKULKLGCOJRY-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(CCOC)C=C1)C2=C(B(O)O)C=CC=C2
Synonyms:
  • B-[2-[[4-(2-Methoxyethyl)phenoxy]methyl]phenyl]boronic acid
  • Boronic acid, B-[2-[[4-(2-methoxyethyl)phenoxy]methyl]phenyl]-
  • Boronic acid, [2-[[4-(2-methoxyethyl)phenoxy]methyl]phenyl]-
Found 4 products.