CymitQuimica logo

CAS 87121-89-9

:

Ethyl 3-oxocyclobutanecarboxylate

Description:
Ethyl 3-oxocyclobutanecarboxylate is an organic compound characterized by its unique cyclobutane ring structure, which contributes to its chemical reactivity and properties. It features a ketone functional group (3-oxo) and an ester group (ethyl ester), making it a versatile intermediate in organic synthesis. The presence of these functional groups allows for various chemical reactions, including nucleophilic additions and condensation reactions. Ethyl 3-oxocyclobutanecarboxylate is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its molecular structure provides potential applications in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, the compound's reactivity can be influenced by the steric and electronic effects of substituents on the cyclobutane ring, making it a subject of interest in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H10O3
InChI:InChI=1/C7H10O3/c1-2-10-7(9)5-3-6(8)4-5/h5H,2-4H2,1H3
InChI key:BXBRFSMPBOTZHJ-UHFFFAOYSA-N
SMILES:CCOC(=O)C1CC(=O)C1
Synonyms:
  • Cyclobutanecarboxylic Acid, 3-Oxo-, Ethyl Ester
  • Ethyl 3-Oxo Cyclobuatne Carboxylate
Found 4 products.