CymitQuimica logo

CAS 871224-19-0

:

Methyl 3-bromo-2-chlorobenzoate

Description:
Methyl 3-bromo-2-chlorobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both bromine and chlorine atoms, as well as an ester functional group. The presence of the bromine and chlorine substituents contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic aromatic structure. Methyl 3-bromo-2-chlorobenzoate can be utilized in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of more complex organic molecules. Safety precautions should be observed when handling this compound, as it may pose health risks due to the presence of halogenated substituents. Proper storage and disposal methods should be followed to mitigate environmental impact.
Formula:C8H6BrClO2
InChI:InChI=1S/C8H6BrClO2/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4H,1H3
InChI key:OWPJVOSLLKRKQJ-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C(=CC=C1)Br)Cl
Found 4 products.