CAS 871239-18-8
:2-Amino-5-cyano-3-methylbenzoic acid
Description:
2-Amino-5-cyano-3-methylbenzoic acid, with the CAS number 871239-18-8, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group, a cyano group, and a methyl group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid and amino groups. The cyano group contributes to its potential reactivity and polarity, making it useful in various chemical syntheses and applications. The methyl group influences the compound's hydrophobicity and steric properties. In terms of solubility, it is likely to be soluble in polar solvents due to the presence of the carboxylic acid and amino groups. The compound may also exhibit biological activity, which could be of interest in pharmaceutical research. Overall, 2-Amino-5-cyano-3-methylbenzoic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-5-2-6(4-10)3-7(8(5)11)9(12)13/h2-3H,11H2,1H3,(H,12,13)
InChI key:InChIKey=FYPIIMYXBCWBPQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C(C)=CC(C#N)=C1
Synonyms:- Benzoic acid, 2-amino-5-cyano-3-methyl-
- 2-Amino-5-cyano-3-methylbenzoic acid
- 5-Cyano-2-amino-3-methylbenzoic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Amino-5-cyano-3-methylbenzoic acid
CAS:2-Amino-5-cyano-3-methylbenzoic acidFormula:C9H8N2O2Purity:98%Molecular weight:176.172-AMino-5-cyano-3-Methylbenzoic acid
CAS:Formula:C9H8N2O2Purity:98%Color and Shape:SolidMolecular weight:176.17202-Amino-5-cyano-3-methylbenzoic acid
CAS:2-Amino-5-cyano-3-methylbenzoic acidFormula:C9H8N2O2Purity:98%Molecular weight:176.172-AMINO-5-CYANO-3-METHYLBENZOIC ACID
CAS:Formula:C9H8N2O2Purity:98%Color and Shape:SolidMolecular weight:176.1752-Amino-5-cyano-3-methylbenzoicAcid
CAS:Controlled ProductApplications 2-Amino-5-cyano-3-methylbenzoic Acid (cas# 871239-18-8) is a useful research chemical.
Formula:C9H8N2O2Color and Shape:NeatMolecular weight:176.1722-amino-5-cyano-3-methylbenzoic acid
CAS:2-Amino-5-cyano-3-methylbenzoic acid is a diester of methylamine. It is an acid ester that has been used in the synthesis of other compounds. 2-Amino-5-cyano-3-methylbenzoic acid is an intermediate in the synthesis of some pharmaceuticals, such as carbamazepine and methylphenidate. This compound has not been shown to have any biological activity.Formula:C9H8N2O2Purity:Min. 95%Molecular weight:176.18 g/mol





