CymitQuimica logo

CAS 871317-00-9

:

Thieno[3,2-d]pyrimidine, 6-(4-fluorophenyl)-4-[(1-methyl-1H-tetrazol-5-yl)thio]-

Description:
Thieno[3,2-d]pyrimidine, 6-(4-fluorophenyl)-4-[(1-methyl-1H-tetrazol-5-yl)thio]- is a heterocyclic compound characterized by its unique fused ring structure, which includes a thieno and pyrimidine moiety. The presence of a 4-fluorophenyl group introduces a fluorine atom, enhancing the compound's electronic properties and potentially influencing its biological activity. Additionally, the compound features a thioether linkage to a 1-methyl-1H-tetrazole, which is known for its ability to participate in various chemical reactions and interactions. This combination of structural elements suggests that the compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific interactions and reactivity can be influenced by the presence of the fluorine atom and the tetrazole group, which may enhance solubility and bioavailability. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with potential applications in drug development and other fields.
Formula:C14H9FN6S2
InChI:InChI=1S/C14H9FN6S2/c1-21-14(18-19-20-21)23-13-12-10(16-7-17-13)6-11(22-12)8-2-4-9(15)5-3-8/h2-7H,1H3
InChI key:OIWWJQSEDKTATE-UHFFFAOYSA-N
SMILES:CN1C(=NN=N1)SC2=NC=NC3=C2SC(=C3)C4=CC=C(C=C4)F
Synonyms:
  • Thieno[3,2-d]pyrimidine, 6-(4-fluorophenyl)-4-[(1-methyl-1H-tetrazol-5-yl)thio]-
  • 6-(4-Fluorophenyl)-4-((1-methyl-1H-tetrazol-5-yl)thio)thieno[3,2-d]pyrimidine
Found 2 products.