CymitQuimica logo

CAS 871700-29-7

:

2-(1H-indol-3-yl)-N-{2-[(4-methoxyphenyl)amino]-1-(4-methylphenyl)-2-oxoethyl}-N-methylacetamide

Description:
The chemical substance known as 2-(1H-indol-3-yl)-N-{2-[(4-methoxyphenyl)amino]-1-(4-methylphenyl)-2-oxoethyl}-N-methylacetamide, with the CAS number 871700-29-7, is a synthetic compound characterized by its complex molecular structure, which includes an indole moiety and an acetamide functional group. This compound features multiple aromatic rings, contributing to its potential biological activity and interactions. The presence of methoxy and methyl substituents on the phenyl rings may influence its solubility, stability, and reactivity. Typically, compounds of this nature are investigated for their pharmacological properties, including potential anti-cancer or anti-inflammatory effects, due to the indole structure's known biological significance. The specific arrangement of functional groups suggests that it may engage in hydrogen bonding and π-π stacking interactions, which are critical for its biological activity. As with many synthetic organic compounds, understanding its characteristics requires consideration of its physical properties, such as melting point, solubility, and spectral data, which are essential for applications in medicinal chemistry and drug development.
Formula:C27H27N3O3
InChI:InChI=1S/C27H27N3O3/c1-18-8-10-19(11-9-18)26(27(32)29-21-12-14-22(33-3)15-13-21)30(2)25(31)16-20-17-28-24-7-5-4-6-23(20)24/h4-15,17,26,28H,16H2,1-3H3,(H,29,32)
InChI key:SHUDPPSLXZZLQS-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C(C(=O)NC2=CC=C(C=C2)OC)N(C)C(=O)CC3=CNC4=CC=CC=C43
Synonyms:
  • 1H-Indole-3-acetamide, N-[2-[(4-methoxyphenyl)amino]-1-(4-methylphenyl)-2-oxoethyl]-N-methyl-
  • WAY-326769
  • 2-(1H-indol-3-yl)-N-{2-[(4-methoxyphenyl)amino]-1-(4-methylphenyl)-2-oxoethyl}-N-methylacetamide
Found 3 products.