CymitQuimica logo

CAS 871727-37-6

:

2-Azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid, 2-(1,1-dimethylethyl)3-ethyl ester, (1R,3R,5R)-

Description:
2-Azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid, 2-(1,1-dimethylethyl)-3-ethyl ester, (1R,3R,5R)- is a bicyclic compound characterized by its unique azabicyclo structure, which incorporates a nitrogen atom into a bicyclic framework. This compound features two carboxylic acid functional groups, contributing to its potential acidity and reactivity. The presence of the tert-butyl and ethyl ester groups enhances its lipophilicity, which may influence its solubility and biological activity. The stereochemistry indicated by the (1R,3R,5R) configuration suggests specific spatial arrangements of substituents, which can significantly affect the compound's interactions in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to various pharmacological properties. Additionally, its CAS number, 871727-37-6, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug design and synthesis. Overall, the compound's unique structure and functional groups make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C13H21NO4
InChI:InChI=1S/C13H21NO4/c1-5-17-11(15)10-7-8-6-9(8)14(10)12(16)18-13(2,3)4/h8-10H,5-7H2,1-4H3/t8-,9-,10-/m1/s1
InChI key:QHWOZJGWXZDMDZ-OPRDCNLKSA-N
SMILES:CCOC(=O)[C@H]1C[C@H]2C[C@H]2N1C(=O)OC(C)(C)C
Found 6 products.