CymitQuimica logo

CAS 87184-99-4

:

4-{[tert-butyl(dimethyl)silyl]oxy}butan-1-ol

Description:
4-{[tert-butyl(dimethyl)silyl]oxy}butan-1-ol, with the CAS number 87184-99-4, is an organic compound characterized by its siloxy functional group and alcohol moiety. This compound features a butanol backbone, which contributes to its solubility in polar solvents, while the tert-butyl(dimethyl)silyl group enhances its hydrophobic properties. The presence of the silyl group often provides increased stability against hydrolysis and can improve the compound's volatility and reactivity in various chemical reactions. Additionally, the tert-butyl group can sterically hinder reactions, influencing the compound's reactivity profile. This compound is typically used in organic synthesis, particularly in protecting group strategies in the synthesis of more complex molecules. Its unique structure allows for selective reactions, making it valuable in synthetic organic chemistry. Overall, 4-{[tert-butyl(dimethyl)silyl]oxy}butan-1-ol is a versatile compound with applications in both academic research and industrial processes.
Formula:C10H24O2Si
InChI:InChI=1/C10H24O2Si/c1-10(2,3)13(4,5)12-9-7-6-8-11/h11H,6-9H2,1-5H3
InChI key:IJEMXJANZPVITP-UHFFFAOYSA-N
SMILES:CC(C)(C)[Si](C)(C)OCCCCO
Found 8 products.