CymitQuimica logo

CAS 871940-31-7

:

2,4-Difluoro-3-cyanophenylboronic acid

Description:
2,4-Difluoro-3-cyanophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features two fluorine atoms at the 2 and 4 positions of the phenyl ring, which can influence its electronic properties and reactivity. The presence of a cyano group at the 3-position further enhances its polarity and can participate in various chemical reactions. This compound is typically a solid at room temperature and is soluble in polar organic solvents. Its boronic acid functionality allows it to act as a versatile building block in the synthesis of complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the unique combination of fluorine and cyano substituents may impart specific biological activities, making it a subject of interest in drug discovery and development.
Formula:C7H4NO2BF2
InChI:InChI=1S/C7H4BF2NO2/c9-6-2-1-5(8(12)13)7(10)4(6)3-11/h1-2,12-13H
InChI key:VQEKFJVJHSVFTM-UHFFFAOYSA-N
SMILES:B(C1=C(C(=C(C=C1)F)C#N)F)(O)O
Synonyms:
  • (3-Cyano-2,4-difluorophenyl)boronic acid
Found 5 products.