CymitQuimica logo

CAS 872047-67-1

:

quinoxalin-6-ylmethanamine

Description:
Quinoxalin-6-ylmethanamine is an organic compound characterized by the presence of a quinoxaline ring, which is a bicyclic structure composed of two fused aromatic rings containing nitrogen atoms. This compound features a methanamine group (-CH2NH2) attached to the quinoxaline at the 6-position, which contributes to its reactivity and potential biological activity. Quinoxalin-6-ylmethanamine is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoxaline derivatives are known for various biological activities, including antimicrobial and anticancer properties. The compound's properties, such as melting point, boiling point, and specific reactivity, would depend on its purity and the conditions under which it is handled. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding, influencing its interactions in biological systems.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c10-6-7-1-2-8-9(5-7)12-4-3-11-8/h1-5H,6,10H2
InChI key:LNYPHLYYOBNSPF-UHFFFAOYSA-N
SMILES:c1cc2c(cc1CN)nccn2
Synonyms:
  • 1-(Quinoxalin-6-yl)methanamine
  • 6-Quinoxalinemethanamine
Found 2 products.