CymitQuimica logo

CAS 87219-22-5

:

1-Imidazolidineaceticacid, 2-oxo-

Description:
1-Imidazolidineacetic acid, 2-oxo- (CAS 87219-22-5) is a chemical compound characterized by its imidazolidine ring structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a carboxylic acid functional group and a keto group, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which enhances its utility in various chemical reactions and applications. The presence of the imidazolidine moiety suggests potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. Its structural features may allow it to participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use. Overall, 1-Imidazolidineacetic acid, 2-oxo- represents a unique compound with potential applications in pharmaceuticals and biochemistry.
Formula:C5H8N2O3
InChI:InChI=1S/C5H8N2O3/c8-4(9)3-7-2-1-6-5(7)10/h1-3H2,(H,6,10)(H,8,9)
InChI key:SIAWJUIPAYPCEJ-UHFFFAOYSA-N
SMILES:C1CN(C(=O)N1)CC(=O)O
Found 5 products.