CymitQuimica logo

CAS 872696-24-7

:

4-(Methylamino)-2-pyridinecarboxylic acid

Description:
4-(Methylamino)-2-pyridinecarboxylic acid, also known by its CAS number 872696-24-7, is an organic compound characterized by a pyridine ring substituted with a carboxylic acid and a methylamino group. This compound typically exhibits properties associated with both aromatic and aliphatic amines, including potential basicity due to the presence of the amino group. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, making it useful in various chemical reactions and applications. The presence of the methylamino group can influence its reactivity and interactions with biological systems, potentially making it relevant in pharmaceutical chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and analysis in laboratory settings. Overall, 4-(Methylamino)-2-pyridinecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c1-8-5-2-3-9-6(4-5)7(10)11/h2-4H,1H3,(H,8,9)(H,10,11)
InChI key:InChIKey=DGQGIUNYNBRAKU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(NC)=CC=N1
Synonyms:
  • 2-Pyridinecarboxylic acid, 4-(methylamino)-
  • 4-(Methylamino)-2-pyridinecarboxylic acid
  • 4-(methylamino)picolinic acid
  • Sorafenib impurity INT-1-G
Found 3 products.