CymitQuimica logo

CAS 873-49-4

:

Phenylcyclopropane

Description:
Phenylcyclopropane is an organic compound characterized by a cyclopropane ring bonded to a phenyl group. Its molecular structure consists of a three-membered cyclopropane ring, which is known for its strain due to the angle constraints, and a phenyl group, which is a benzene ring minus one hydrogen atom. This compound is typically a colorless liquid with a distinctive aromatic odor. Phenylcyclopropane is notable for its unique combination of cyclic and aromatic characteristics, which can influence its reactivity and stability. It is relatively stable under standard conditions but can undergo various chemical reactions, including electrophilic substitutions and ring-opening reactions under certain conditions. The compound has applications in organic synthesis and may serve as an intermediate in the production of more complex molecules. Its properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety precautions should be taken when handling phenylcyclopropane due to its potential health effects.
Formula:C9H10
InChI:InChI=1S/C9H10/c1-2-4-8(5-3-1)9-6-7-9/h1-5,9H,6-7H2
InChI key:InChIKey=VFSFCYAQBIPUSL-UHFFFAOYSA-N
SMILES:C1(CC1)C2=CC=CC=C2
Synonyms:
  • 1-Phenylcyclopropane
  • Benzene, cyclopropyl-
  • Cyclopropane, phenyl-
  • Cyclopropyl benzene
  • Nsc 3018
  • Phenylcyclopropane
  • Cyclopropylbenzene
Found 5 products.