CymitQuimica logo

CAS 873006-01-0

:

Benzaldehyde, 2-iodo-4-(trifluoromethyl)-

Description:
Benzaldehyde, 2-iodo-4-(trifluoromethyl)- is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with both an iodine atom and a trifluoromethyl group. The presence of the iodine atom at the 2-position and the trifluoromethyl group at the 4-position significantly influences its chemical reactivity and physical properties. This compound is typically a colorless to pale yellow liquid with a distinct aromatic odor. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the iodine and trifluoromethyl groups. The trifluoromethyl group enhances lipophilicity and can improve the biological activity of derivatives. Additionally, benzaldehyde derivatives often exhibit interesting electronic properties, making them valuable in materials science and as intermediates in various chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks upon exposure.
Formula:C8H4F3IO
InChI:InChI=1S/C8H4F3IO/c9-8(10,11)6-2-1-5(4-13)7(12)3-6/h1-4H
InChI key:YXBXQINPERBCIR-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C(F)(F)F)I)C=O
Synonyms:
  • 2-Iodo-4-trifluoromethylbenzaldehyde
Found 4 products.