CAS 873080-25-2

4-Pyrimidinecarboxamide, 5-chloro-N-[(4-chlorophenyl)methyl]-2-(ethylsulfonyl)-N-(2-furanylmethyl)-

Description:

4-Pyrimidinecarboxamide, 5-chloro-N-[(4-chlorophenyl)methyl]-2-(ethylsulfonyl)-N-(2-furanylmethyl)- is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine ring, a carboxamide functional group, and multiple substituents such as chloro, ethylsulfonyl, and furanylmethyl groups. This compound is typically classified as a pharmaceutical intermediate or a potential drug candidate, often investigated for its biological activity, particularly in the context of medicinal chemistry. The presence of the chloro and sulfonyl groups may influence its solubility, stability, and reactivity, while the furanylmethyl moiety could contribute to its pharmacological properties. The compound's molecular interactions, including hydrogen bonding and hydrophobic interactions, are crucial for its biological efficacy. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies, including in vitro and in vivo evaluations, are necessary to fully understand its therapeutic potential and mechanism of action.

Formula: C₁₉H₁₇Cl₂N₃O₄S

InChI: InChI=1S/C19H17Cl2N3O4S/c1-2-29(26,27)19-22-10-16(21)17(23-19)18(25)24(12-15-4-3-9-28-15)11-13-5-7-14(20)8-6-13/h3-10H,2,11-12H2,1H3

InChI key: GTWKIPDKVRLUKN-UHFFFAOYSA-N

SMILES: CCS(=O)(=O)C1=NC=C(C(=N1)C(=O)N(CC2=CC=C(C=C2)Cl)CC3=CC=CO3)Cl

Synonyms:

• 4-Pyrimidinecarboxamide, 5-chloro-N-[(4-chlorophenyl)methyl]-2-(ethylsulfonyl)-N-(2-furanylmethyl)-
• Inhibitor,autoimmune,ZAP-70,tyrosine,T-cell,ZAP 180013,ZAP180013,Tyrosinase,ZAP-180013,antigen,inhibit
• ZAP 180013

ZAP-180013

CAS: 873080-25-2

ZAP-180013

Formula: C₁₉H₁₇Cl₂N₃O₄S

Purity: ≥98%

Molecular weight: 454.33

Ref: 54-BUP06659

ZAP-180013

CAS: 873080-25-2

Formula: C₁₉H₁₇Cl₂N₃O₄S

Purity: 99%

Molecular weight: 454.327

Ref: IN-DA01LMUU

5-Chloro-N-(4-Chlorobenzyl)-2-(Ethylsulfonyl)-N-(Furan-2-Ylmethyl)Pyrimidine-4-Carboxamide

CAS: 873080-25-2

5-Chloro-N-(4-Chlorobenzyl)-2-(Ethylsulfonyl)-N-(Furan-2-Ylmethyl)Pyrimidine-4-Carboxamide

Formula: C₁₉H₁₇Cl₂N₃O₄S

Purity: 99%

Molecular weight: 454.33

Ref: 54-OR1023169

ZAP-180013

CAS: 873080-25-2

ZAP-180013 is an inhibitor of zeta-chain-associated protein kinase 70 (ZAP70,IC50 : 1.8 μM).

Formula: C₁₉H₁₇Cl₂N₃O₄S

Purity: 98.89%

Color and Shape: White Solid

Molecular weight: 454.327

Ref: TM-T8697

ZAP-180013

CAS: 873080-25-2

5-Chloro-N-(4-chlorobenzyl)-2-(ethylsulfonyl)-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide

Formula: C₁₉H₁₇Cl₂N₃O₄S

Purity: 99%

Molecular weight: 454.33

Ref: IN-DG01266141

ZAP 180013

CAS: 873080-25-2

ZAP 180013 is an advanced enzymatic reagent, which is derived from a recombinant source with specificity for targeted protein modification. It operates through a unique mechanism of action that involves the precise cleavage of peptide bonds at target sites identified by a specific amino acid sequence. This specificity allows for minimal off-target effects, making it a reliable tool in proteomics.

Formula: C₁₉H₁₇Cl₂N₃O₄S

Purity: Min. 95%

Molecular weight: 454.3 g/mol

Ref: 3D-YJB08025