CymitQuimica logo

CAS 873429-58-4

:

2,3,4-Trifluoro-L-phenylalanine

Description:
2,3,4-Trifluoro-L-phenylalanine is a fluorinated derivative of the amino acid phenylalanine, characterized by the presence of three fluorine atoms attached to the benzene ring at the 2, 3, and 4 positions. This modification significantly alters its chemical properties compared to non-fluorinated phenylalanine. The introduction of fluorine atoms enhances the lipophilicity and metabolic stability of the compound, which can influence its interactions in biological systems. It is often utilized in research related to protein engineering and drug design, as the fluorinated phenylalanine can be incorporated into peptides and proteins to study structure-function relationships. The compound is typically solid at room temperature and may exhibit unique solubility characteristics due to the presence of fluorine. Additionally, its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of therapeutics that require specific interactions with biological targets. As with many fluorinated compounds, safety and handling precautions should be observed due to the potential for toxicity and environmental impact.
Formula:C9H8F3NO2
InChI:InChI=1/C9H8F3NO2/c10-5-2-1-4(7(11)8(5)12)3-6(13)9(14)15/h1-2,6H,3,13H2,(H,14,15)/t6-/m0/s1
InChI key:InChIKey=FGKZSVVTLDUTMM-LURJTMIESA-N
SMILES:C([C@@H](C(O)=O)N)C1=C(F)C(F)=C(F)C=C1
Synonyms:
  • 2,3,4-Trifluoro-L-phenylalanine
  • (S)-2-Amino-3-(2,3,4-trifluorophenyl)propanoicacid
  • L-Phenylalanine, 2,3,4-trifluoro-
  • See more synonyms
Found 3 products.